C25H44O2 — CID 170105433
3-(5,5-dimethylhexyl)-5-(7,7-dimethylnonyl)benzene-1,2-diol (PubChem CID 170105433) has the molecular formula C25H44O2 and a molecular weight of 376.63 g/mol. Its IUPAC name is 3-(5,5-dimethylhexyl)-5-(7,7-dimethylnonyl)benzene-1,2-diol.
| Compound Name | 3-(5,5-dimethylhexyl)-5-(7,7-dimethylnonyl)benzene-1,2-diol |
|---|---|
| PubChem CID | 170105433 |
| Molecular Formula | C25H44O2 |
| Molecular Weight | 376.63 g/mol |
| Exact Mass | 376.33 |
| IUPAC Name | 3-(5,5-dimethylhexyl)-5-(7,7-dimethylnonyl)benzene-1,2-diol |
| SMILES | CCC(C)(C)CCCCCCc1cc(O)c(O)c(CCCCC(C)(C)C)c1 |
| InChI | InChI=1S/C25H44O2/c1-7-25(5,6)17-12-9-8-10-14-20-18-21(23(27)22(26)19-20)15-11-13-16-24(2,3)4/h18-19,26-27H,7-17H2,1-6H3 |
| InChIKey | ZNQRNRJMSUKOBU-UHFFFAOYSA-N |
| XLogP | 7.79 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.63 |
| LogP ≤ 5 | 7.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|