C23H40O2 — CID 170106028
2-(5,5-dimethylheptyl)-3-(5,5-dimethylhexyl)benzene-1,4-diol (PubChem CID 170106028) has the molecular formula C23H40O2 and a molecular weight of 348.57 g/mol. Its IUPAC name is 2-(5,5-dimethylheptyl)-3-(5,5-dimethylhexyl)benzene-1,4-diol.
| Compound Name | 2-(5,5-dimethylheptyl)-3-(5,5-dimethylhexyl)benzene-1,4-diol |
|---|---|
| PubChem CID | 170106028 |
| Molecular Formula | C23H40O2 |
| Molecular Weight | 348.57 g/mol |
| Exact Mass | 348.30 |
| IUPAC Name | 2-(5,5-dimethylheptyl)-3-(5,5-dimethylhexyl)benzene-1,4-diol |
| SMILES | CCC(C)(C)CCCCc1c(O)ccc(O)c1CCCCC(C)(C)C |
| InChI | InChI=1S/C23H40O2/c1-7-23(5,6)17-11-9-13-19-18(20(24)14-15-21(19)25)12-8-10-16-22(2,3)4/h14-15,24-25H,7-13,16-17H2,1-6H3 |
| InChIKey | DMSBOUMQEVEYAQ-UHFFFAOYSA-N |
| XLogP | 7.01 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.57 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|