C26H44O2 — CID 170106282
2-(7,7-dimethylnonyl)-3-[5-(1-methylcyclopropyl)pentyl]benzene-1,4-diol (PubChem CID 170106282) has the molecular formula C26H44O2 and a molecular weight of 388.64 g/mol. Its IUPAC name is 2-(7,7-dimethylnonyl)-3-[5-(1-methylcyclopropyl)pentyl]benzene-1,4-diol.
| Compound Name | 2-(7,7-dimethylnonyl)-3-[5-(1-methylcyclopropyl)pentyl]benzene-1,4-diol |
|---|---|
| PubChem CID | 170106282 |
| Molecular Formula | C26H44O2 |
| Molecular Weight | 388.64 g/mol |
| Exact Mass | 388.33 |
| IUPAC Name | 2-(7,7-dimethylnonyl)-3-[5-(1-methylcyclopropyl)pentyl]benzene-1,4-diol |
| SMILES | CCC(C)(C)CCCCCCc1c(O)ccc(O)c1CCCCCC1(C)CC1 |
| InChI | InChI=1S/C26H44O2/c1-5-25(2,3)17-11-7-6-9-13-21-22(24(28)16-15-23(21)27)14-10-8-12-18-26(4)19-20-26/h15-16,27-28H,5-14,17-20H2,1-4H3 |
| InChIKey | XOUBXMUKUGFMOE-UHFFFAOYSA-N |
| XLogP | 7.93 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.64 |
| LogP ≤ 5 | 7.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|