C21H34O3 — CID 170106403
6-(4,4-dimethylhexyl)-5-[3-(1-methylcyclopropyl)propyl]benzene-1,2,4-triol (PubChem CID 170106403) has the molecular formula C21H34O3 and a molecular weight of 334.50 g/mol. Its IUPAC name is 6-(4,4-dimethylhexyl)-5-[3-(1-methylcyclopropyl)propyl]benzene-1,2,4-triol.
| Compound Name | 6-(4,4-dimethylhexyl)-5-[3-(1-methylcyclopropyl)propyl]benzene-1,2,4-triol |
|---|---|
| PubChem CID | 170106403 |
| Molecular Formula | C21H34O3 |
| Molecular Weight | 334.50 g/mol |
| Exact Mass | 334.25 |
| IUPAC Name | 6-(4,4-dimethylhexyl)-5-[3-(1-methylcyclopropyl)propyl]benzene-1,2,4-triol |
| SMILES | CCC(C)(C)CCCc1c(O)c(O)cc(O)c1CCCC1(C)CC1 |
| InChI | InChI=1S/C21H34O3/c1-5-20(2,3)10-6-9-16-15(8-7-11-21(4)12-13-21)17(22)14-18(23)19(16)24/h14,22-24H,5-13H2,1-4H3 |
| InChIKey | GOIMMDSHKWHUFQ-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.50 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|