C20H28O7 — CID 155770956
1-[3-[2-(4-carboxy-4-methylpentyl)-3,5,6-trihydroxyphenyl]propyl]cyclopropane-1-carboxylic acid (PubChem CID 155770956) has the molecular formula C20H28O7 and a molecular weight of 380.44 g/mol. Its IUPAC name is 1-[3-[2-(4-carboxy-4-methylpentyl)-3,5,6-trihydroxyphenyl]propyl]cyclopropane-1-carboxylic acid.
| Compound Name | 1-[3-[2-(4-carboxy-4-methylpentyl)-3,5,6-trihydroxyphenyl]propyl]cyclopropane-1-carboxylic acid |
|---|---|
| PubChem CID | 155770956 |
| Molecular Formula | C20H28O7 |
| Molecular Weight | 380.44 g/mol |
| Exact Mass | 380.18 |
| IUPAC Name | 1-[3-[2-(4-carboxy-4-methylpentyl)-3,5,6-trihydroxyphenyl]propyl]cyclopropane-1-carboxylic acid |
| SMILES | CC(C)(CCCc1c(O)cc(O)c(O)c1CCCC1(C(=O)O)CC1)C(=O)O |
| InChI | InChI=1S/C20H28O7/c1-19(2,17(24)25)7-3-5-12-13(16(23)15(22)11-14(12)21)6-4-8-20(9-10-20)18(26)27/h11,21-23H,3-10H2,1-2H3,(H,24,25)(H,26,27) |
| InChIKey | OOEWNFXWXWPDMA-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 135.29 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.44 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|