C20H32O5 — CID 158913397
5-[2-(4,4-dimethylpentyl)-3,5,6-trihydroxyphenyl]-2,2-dimethylpentanoic acid (PubChem CID 158913397) has the molecular formula C20H32O5 and a molecular weight of 352.47 g/mol. Its IUPAC name is 5-[2-(4,4-dimethylpentyl)-3,5,6-trihydroxyphenyl]-2,2-dimethylpentanoic acid.
| Compound Name | 5-[2-(4,4-dimethylpentyl)-3,5,6-trihydroxyphenyl]-2,2-dimethylpentanoic acid |
|---|---|
| PubChem CID | 158913397 |
| Molecular Formula | C20H32O5 |
| Molecular Weight | 352.47 g/mol |
| Exact Mass | 352.22 |
| IUPAC Name | 5-[2-(4,4-dimethylpentyl)-3,5,6-trihydroxyphenyl]-2,2-dimethylpentanoic acid |
| SMILES | CC(C)(C)CCCc1c(O)cc(O)c(O)c1CCCC(C)(C)C(=O)O |
| InChI | InChI=1S/C20H32O5/c1-19(2,3)10-6-8-13-14(17(23)16(22)12-15(13)21)9-7-11-20(4,5)18(24)25/h12,21-23H,6-11H2,1-5H3,(H,24,25) |
| InChIKey | FZHGBMPQNONRHC-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.47 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|