C26H40O6 — CID 155596186
1-[6-[3-(7-carboxy-7-methyloctyl)-2,6-dihydroxyphenyl]hexyl]cyclopropane-1-carboxylic acid (PubChem CID 155596186) has the molecular formula C26H40O6 and a molecular weight of 448.60 g/mol. Its IUPAC name is 1-[6-[3-(7-carboxy-7-methyloctyl)-2,6-dihydroxyphenyl]hexyl]cyclopropane-1-carboxylic acid.
| Compound Name | 1-[6-[3-(7-carboxy-7-methyloctyl)-2,6-dihydroxyphenyl]hexyl]cyclopropane-1-carboxylic acid |
|---|---|
| PubChem CID | 155596186 |
| Molecular Formula | C26H40O6 |
| Molecular Weight | 448.60 g/mol |
| Exact Mass | 448.28 |
| IUPAC Name | 1-[6-[3-(7-carboxy-7-methyloctyl)-2,6-dihydroxyphenyl]hexyl]cyclopropane-1-carboxylic acid |
| SMILES | CC(C)(CCCCCCc1ccc(O)c(CCCCCCC2(C(=O)O)CC2)c1O)C(=O)O |
| InChI | InChI=1S/C26H40O6/c1-25(2,23(29)30)15-9-5-3-7-11-19-13-14-21(27)20(22(19)28)12-8-4-6-10-16-26(17-18-26)24(31)32/h13-14,27-28H,3-12,15-18H2,1-2H3,(H,29,30)(H,31,32) |
| InChIKey | IYVASIVZIQGSRD-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 115.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.60 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|