C28H44O4 — CID 155770622
1-[6-[2-(7-carboxy-7-methyloctyl)-4,5-dimethylphenyl]hexyl]cyclopropane-1-carboxylic acid (PubChem CID 155770622) has the molecular formula C28H44O4 and a molecular weight of 444.66 g/mol. Its IUPAC name is 1-[6-[2-(7-carboxy-7-methyloctyl)-4,5-dimethylphenyl]hexyl]cyclopropane-1-carboxylic acid.
| Compound Name | 1-[6-[2-(7-carboxy-7-methyloctyl)-4,5-dimethylphenyl]hexyl]cyclopropane-1-carboxylic acid |
|---|---|
| PubChem CID | 155770622 |
| Molecular Formula | C28H44O4 |
| Molecular Weight | 444.66 g/mol |
| Exact Mass | 444.32 |
| IUPAC Name | 1-[6-[2-(7-carboxy-7-methyloctyl)-4,5-dimethylphenyl]hexyl]cyclopropane-1-carboxylic acid |
| SMILES | Cc1cc(CCCCCCC(C)(C)C(=O)O)c(CCCCCCC2(C(=O)O)CC2)cc1C |
| InChI | InChI=1S/C28H44O4/c1-21-19-23(13-9-5-7-11-15-27(3,4)25(29)30)24(20-22(21)2)14-10-6-8-12-16-28(17-18-28)26(31)32/h19-20H,5-18H2,1-4H3,(H,29,30)(H,31,32) |
| InChIKey | DJIJRIMKJGOIKP-UHFFFAOYSA-N |
| XLogP | 7.27 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.66 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|