C26H40O4 — CID 155596238
1-[4-[3-(7-carboxy-7-methyloctyl)-2,6-dimethylphenyl]butyl]cyclopropane-1-carboxylic acid (PubChem CID 155596238) has the molecular formula C26H40O4 and a molecular weight of 416.60 g/mol. Its IUPAC name is 1-[4-[3-(7-carboxy-7-methyloctyl)-2,6-dimethylphenyl]butyl]cyclopropane-1-carboxylic acid.
| Compound Name | 1-[4-[3-(7-carboxy-7-methyloctyl)-2,6-dimethylphenyl]butyl]cyclopropane-1-carboxylic acid |
|---|---|
| PubChem CID | 155596238 |
| Molecular Formula | C26H40O4 |
| Molecular Weight | 416.60 g/mol |
| Exact Mass | 416.29 |
| IUPAC Name | 1-[4-[3-(7-carboxy-7-methyloctyl)-2,6-dimethylphenyl]butyl]cyclopropane-1-carboxylic acid |
| SMILES | Cc1ccc(CCCCCCC(C)(C)C(=O)O)c(C)c1CCCCC1(C(=O)O)CC1 |
| InChI | InChI=1S/C26H40O4/c1-19-13-14-21(11-7-5-6-9-15-25(3,4)23(27)28)20(2)22(19)12-8-10-16-26(17-18-26)24(29)30/h13-14H,5-12,15-18H2,1-4H3,(H,27,28)(H,29,30) |
| InChIKey | VMZGDRLHQDEQMG-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.60 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|