C23H34O4 — CID 155770758
1-[4-[2-(5-carboxy-5-methylhexyl)-4-methylphenyl]butyl]cyclopropane-1-carboxylic acid (PubChem CID 155770758) has the molecular formula C23H34O4 and a molecular weight of 374.52 g/mol. Its IUPAC name is 1-[4-[2-(5-carboxy-5-methylhexyl)-4-methylphenyl]butyl]cyclopropane-1-carboxylic acid.
| Compound Name | 1-[4-[2-(5-carboxy-5-methylhexyl)-4-methylphenyl]butyl]cyclopropane-1-carboxylic acid |
|---|---|
| PubChem CID | 155770758 |
| Molecular Formula | C23H34O4 |
| Molecular Weight | 374.52 g/mol |
| Exact Mass | 374.25 |
| IUPAC Name | 1-[4-[2-(5-carboxy-5-methylhexyl)-4-methylphenyl]butyl]cyclopropane-1-carboxylic acid |
| SMILES | Cc1ccc(CCCCC2(C(=O)O)CC2)c(CCCCC(C)(C)C(=O)O)c1 |
| InChI | InChI=1S/C23H34O4/c1-17-10-11-18(8-5-7-13-23(14-15-23)21(26)27)19(16-17)9-4-6-12-22(2,3)20(24)25/h10-11,16H,4-9,12-15H2,1-3H3,(H,24,25)(H,26,27) |
| InChIKey | XVZXDJPMPTZYDC-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.52 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|