C25H42O5 — CID 159187056
7-[2-(7,7-dimethyloctyl)-3,5,6-trihydroxyphenyl]-2,2-dimethylheptanoic acid (PubChem CID 159187056) has the molecular formula C25H42O5 and a molecular weight of 422.61 g/mol. Its IUPAC name is 7-[2-(7,7-dimethyloctyl)-3,5,6-trihydroxyphenyl]-2,2-dimethylheptanoic acid.
| Compound Name | 7-[2-(7,7-dimethyloctyl)-3,5,6-trihydroxyphenyl]-2,2-dimethylheptanoic acid |
|---|---|
| PubChem CID | 159187056 |
| Molecular Formula | C25H42O5 |
| Molecular Weight | 422.61 g/mol |
| Exact Mass | 422.30 |
| IUPAC Name | 7-[2-(7,7-dimethyloctyl)-3,5,6-trihydroxyphenyl]-2,2-dimethylheptanoic acid |
| SMILES | CC(C)(C)CCCCCCc1c(O)cc(O)c(O)c1CCCCCC(C)(C)C(=O)O |
| InChI | InChI=1S/C25H42O5/c1-24(2,3)15-11-7-6-9-13-18-19(22(28)21(27)17-20(18)26)14-10-8-12-16-25(4,5)23(29)30/h17,26-28H,6-16H2,1-5H3,(H,29,30) |
| InChIKey | RBPCZMUGQWKZOL-UHFFFAOYSA-N |
| XLogP | 6.56 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.61 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|