C26H42O6 — CID 155771131
8-[2-(7-carboxy-7-methyloctyl)-3,4-dihydroxyphenyl]-2,2-dimethyloctanoic acid (PubChem CID 155771131) has the molecular formula C26H42O6 and a molecular weight of 450.62 g/mol. Its IUPAC name is 8-[2-(7-carboxy-7-methyloctyl)-3,4-dihydroxyphenyl]-2,2-dimethyloctanoic acid.
| Compound Name | 8-[2-(7-carboxy-7-methyloctyl)-3,4-dihydroxyphenyl]-2,2-dimethyloctanoic acid |
|---|---|
| PubChem CID | 155771131 |
| Molecular Formula | C26H42O6 |
| Molecular Weight | 450.62 g/mol |
| Exact Mass | 450.30 |
| IUPAC Name | 8-[2-(7-carboxy-7-methyloctyl)-3,4-dihydroxyphenyl]-2,2-dimethyloctanoic acid |
| SMILES | CC(C)(CCCCCCc1ccc(O)c(O)c1CCCCCCC(C)(C)C(=O)O)C(=O)O |
| InChI | InChI=1S/C26H42O6/c1-25(2,23(29)30)17-11-7-5-9-13-19-15-16-21(27)22(28)20(19)14-10-6-8-12-18-26(3,4)24(31)32/h15-16,27-28H,5-14,17-18H2,1-4H3,(H,29,30)(H,31,32) |
| InChIKey | NIPUELRTGLNFAI-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 115.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.62 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|