C24H38O5 — CID 159795364
1-[5-[2-(6,6-dimethylheptyl)-3,5,6-trihydroxyphenyl]pentyl]cyclopropane-1-carboxylic acid (PubChem CID 159795364) has the molecular formula C24H38O5 and a molecular weight of 406.56 g/mol. Its IUPAC name is 1-[5-[2-(6,6-dimethylheptyl)-3,5,6-trihydroxyphenyl]pentyl]cyclopropane-1-carboxylic acid.
| Compound Name | 1-[5-[2-(6,6-dimethylheptyl)-3,5,6-trihydroxyphenyl]pentyl]cyclopropane-1-carboxylic acid |
|---|---|
| PubChem CID | 159795364 |
| Molecular Formula | C24H38O5 |
| Molecular Weight | 406.56 g/mol |
| Exact Mass | 406.27 |
| IUPAC Name | 1-[5-[2-(6,6-dimethylheptyl)-3,5,6-trihydroxyphenyl]pentyl]cyclopropane-1-carboxylic acid |
| SMILES | CC(C)(C)CCCCCc1c(O)cc(O)c(O)c1CCCCCC1(C(=O)O)CC1 |
| InChI | InChI=1S/C24H38O5/c1-23(2,3)12-8-4-6-10-17-18(21(27)20(26)16-19(17)25)11-7-5-9-13-24(14-15-24)22(28)29/h16,25-27H,4-15H2,1-3H3,(H,28,29) |
| InChIKey | BBGFTNKQMFFTFZ-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.56 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|