C23H36O3 — CID 157385274
1-[5-[2-(5,5-dimethylhexyl)-4-hydroxyphenyl]pentyl]cyclopropane-1-carboxylic acid (PubChem CID 157385274) has the molecular formula C23H36O3 and a molecular weight of 360.54 g/mol. Its IUPAC name is 1-[5-[2-(5,5-dimethylhexyl)-4-hydroxyphenyl]pentyl]cyclopropane-1-carboxylic acid.
| Compound Name | 1-[5-[2-(5,5-dimethylhexyl)-4-hydroxyphenyl]pentyl]cyclopropane-1-carboxylic acid |
|---|---|
| PubChem CID | 157385274 |
| Molecular Formula | C23H36O3 |
| Molecular Weight | 360.54 g/mol |
| Exact Mass | 360.27 |
| IUPAC Name | 1-[5-[2-(5,5-dimethylhexyl)-4-hydroxyphenyl]pentyl]cyclopropane-1-carboxylic acid |
| SMILES | CC(C)(C)CCCCc1cc(O)ccc1CCCCCC1(C(=O)O)CC1 |
| InChI | InChI=1S/C23H36O3/c1-22(2,3)13-8-6-10-19-17-20(24)12-11-18(19)9-5-4-7-14-23(15-16-23)21(25)26/h11-12,17,24H,4-10,13-16H2,1-3H3,(H,25,26) |
| InChIKey | GNAUXZTZJSONHN-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.54 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|