C20H30O3 — CID 170104016
4,5-bis[3-(1-methylcyclopropyl)propyl]benzene-1,2,3-triol (PubChem CID 170104016) has the molecular formula C20H30O3 and a molecular weight of 318.46 g/mol. Its IUPAC name is 4,5-bis[3-(1-methylcyclopropyl)propyl]benzene-1,2,3-triol.
| Compound Name | 4,5-bis[3-(1-methylcyclopropyl)propyl]benzene-1,2,3-triol |
|---|---|
| PubChem CID | 170104016 |
| Molecular Formula | C20H30O3 |
| Molecular Weight | 318.46 g/mol |
| Exact Mass | 318.22 |
| IUPAC Name | 4,5-bis[3-(1-methylcyclopropyl)propyl]benzene-1,2,3-triol |
| SMILES | CC1(CCCc2cc(O)c(O)c(O)c2CCCC2(C)CC2)CC1 |
| InChI | InChI=1S/C20H30O3/c1-19(9-10-19)7-3-5-14-13-16(21)18(23)17(22)15(14)6-4-8-20(2)11-12-20/h13,21-23H,3-12H2,1-2H3 |
| InChIKey | GITPVMFKBLGGBX-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.46 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|