C23H34O5 — CID 157433740
[1-[4-[2,3,6-trihydroxy-5-[5-(1-methylcyclopropyl)pentyl]phenyl]butyl]cyclopropyl] formate (PubChem CID 157433740) has the molecular formula C23H34O5 and a molecular weight of 390.52 g/mol. Its IUPAC name is [1-[4-[2,3,6-trihydroxy-5-[5-(1-methylcyclopropyl)pentyl]phenyl]butyl]cyclopropyl] formate.
| Compound Name | [1-[4-[2,3,6-trihydroxy-5-[5-(1-methylcyclopropyl)pentyl]phenyl]butyl]cyclopropyl] formate |
|---|---|
| PubChem CID | 157433740 |
| Molecular Formula | C23H34O5 |
| Molecular Weight | 390.52 g/mol |
| Exact Mass | 390.24 |
| IUPAC Name | [1-[4-[2,3,6-trihydroxy-5-[5-(1-methylcyclopropyl)pentyl]phenyl]butyl]cyclopropyl] formate |
| SMILES | CC1(CCCCCc2cc(O)c(O)c(CCCCC3(OC=O)CC3)c2O)CC1 |
| InChI | InChI=1S/C23H34O5/c1-22(11-12-22)9-5-2-3-7-17-15-19(25)21(27)18(20(17)26)8-4-6-10-23(13-14-23)28-16-24/h15-16,25-27H,2-14H2,1H3 |
| InChIKey | OVJKVEBQYUHTJC-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.52 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|