C23H34O6 — CID 155770708
7-[5-[4-(1-formyloxycyclopropyl)butyl]-2,3-dihydroxyphenyl]-2,2-dimethylheptanoic acid (PubChem CID 155770708) has the molecular formula C23H34O6 and a molecular weight of 406.52 g/mol. Its IUPAC name is 7-[5-[4-(1-formyloxycyclopropyl)butyl]-2,3-dihydroxyphenyl]-2,2-dimethylheptanoic acid.
| Compound Name | 7-[5-[4-(1-formyloxycyclopropyl)butyl]-2,3-dihydroxyphenyl]-2,2-dimethylheptanoic acid |
|---|---|
| PubChem CID | 155770708 |
| Molecular Formula | C23H34O6 |
| Molecular Weight | 406.52 g/mol |
| Exact Mass | 406.24 |
| IUPAC Name | 7-[5-[4-(1-formyloxycyclopropyl)butyl]-2,3-dihydroxyphenyl]-2,2-dimethylheptanoic acid |
| SMILES | CC(C)(CCCCCc1cc(CCCCC2(OC=O)CC2)cc(O)c1O)C(=O)O |
| InChI | InChI=1S/C23H34O6/c1-22(2,21(27)28)10-6-3-4-9-18-14-17(15-19(25)20(18)26)8-5-7-11-23(12-13-23)29-16-24/h14-16,25-26H,3-13H2,1-2H3,(H,27,28) |
| InChIKey | ABEONPHHHOCIHS-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.52 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|