C27H46O3 — CID 170106499
4-(7,7-dimethylnonyl)-5-[6-(1-methylcyclopropyl)hexyl]benzene-1,2,3-triol (PubChem CID 170106499) has the molecular formula C27H46O3 and a molecular weight of 418.66 g/mol. Its IUPAC name is 4-(7,7-dimethylnonyl)-5-[6-(1-methylcyclopropyl)hexyl]benzene-1,2,3-triol.
| Compound Name | 4-(7,7-dimethylnonyl)-5-[6-(1-methylcyclopropyl)hexyl]benzene-1,2,3-triol |
|---|---|
| PubChem CID | 170106499 |
| Molecular Formula | C27H46O3 |
| Molecular Weight | 418.66 g/mol |
| Exact Mass | 418.34 |
| IUPAC Name | 4-(7,7-dimethylnonyl)-5-[6-(1-methylcyclopropyl)hexyl]benzene-1,2,3-triol |
| SMILES | CCC(C)(C)CCCCCCc1c(CCCCCCC2(C)CC2)cc(O)c(O)c1O |
| InChI | InChI=1S/C27H46O3/c1-5-26(2,3)16-12-8-7-11-15-22-21(20-23(28)25(30)24(22)29)14-10-6-9-13-17-27(4)18-19-27/h20,28-30H,5-19H2,1-4H3 |
| InChIKey | ZUYNAIPMPDHLRH-UHFFFAOYSA-N |
| XLogP | 8.03 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.66 |
| LogP ≤ 5 | 8.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|