C25H42O — CID 170105761
3-(7,7-dimethylnonyl)-5-[4-(1-methylcyclopropyl)butyl]phenol (PubChem CID 170105761) has the molecular formula C25H42O and a molecular weight of 358.61 g/mol. Its IUPAC name is 3-(7,7-dimethylnonyl)-5-[4-(1-methylcyclopropyl)butyl]phenol.
| Compound Name | 3-(7,7-dimethylnonyl)-5-[4-(1-methylcyclopropyl)butyl]phenol |
|---|---|
| PubChem CID | 170105761 |
| Molecular Formula | C25H42O |
| Molecular Weight | 358.61 g/mol |
| Exact Mass | 358.32 |
| IUPAC Name | 3-(7,7-dimethylnonyl)-5-[4-(1-methylcyclopropyl)butyl]phenol |
| SMILES | CCC(C)(C)CCCCCCc1cc(O)cc(CCCCC2(C)CC2)c1 |
| InChI | InChI=1S/C25H42O/c1-5-24(2,3)14-10-7-6-8-12-21-18-22(20-23(26)19-21)13-9-11-15-25(4)16-17-25/h18-20,26H,5-17H2,1-4H3 |
| InChIKey | NQKIKQSRYXRUQM-UHFFFAOYSA-N |
| XLogP | 7.83 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.61 |
| LogP ≤ 5 | 7.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|