C20H31IO2 — CID 170105124
5-(4,4-dimethylhexyl)-3-[3-(1-iodocyclopropyl)propyl]benzene-1,2-diol (PubChem CID 170105124) has the molecular formula C20H31IO2 and a molecular weight of 430.37 g/mol. Its IUPAC name is 5-(4,4-dimethylhexyl)-3-[3-(1-iodocyclopropyl)propyl]benzene-1,2-diol.
| Compound Name | 5-(4,4-dimethylhexyl)-3-[3-(1-iodocyclopropyl)propyl]benzene-1,2-diol |
|---|---|
| PubChem CID | 170105124 |
| Molecular Formula | C20H31IO2 |
| Molecular Weight | 430.37 g/mol |
| Exact Mass | 430.14 |
| IUPAC Name | 5-(4,4-dimethylhexyl)-3-[3-(1-iodocyclopropyl)propyl]benzene-1,2-diol |
| SMILES | CCC(C)(C)CCCc1cc(O)c(O)c(CCCC2(I)CC2)c1 |
| InChI | InChI=1S/C20H31IO2/c1-4-19(2,3)9-5-7-15-13-16(18(23)17(22)14-15)8-6-10-20(21)11-12-20/h13-14,22-23H,4-12H2,1-3H3 |
| InChIKey | MGXLRALYENGAPI-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.37 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|