About 1-(4,4-dimethylhexyl)-3-[3-(1-iodocyclopropyl)propyl]-2,4-dimethylbenzene
1-(4,4-dimethylhexyl)-3-[3-(1-iodocyclopropyl)propyl]-2,4-dimethylbenzene (PubChem CID 170105111) has the molecular formula C22H35I
and a molecular weight of 426.43 g/mol. Its IUPAC name is 1-(4,4-dimethylhexyl)-3-[3-(1-iodocyclopropyl)propyl]-2,4-dimethylbenzene.
Molecular Properties
| Compound Name | 1-(4,4-dimethylhexyl)-3-[3-(1-iodocyclopropyl)propyl]-2,4-dimethylbenzene |
| PubChem CID | 170105111 |
| Molecular Formula | C22H35I |
| Molecular Weight | 426.43 g/mol |
| Exact Mass | 426.18 |
| IUPAC Name | 1-(4,4-dimethylhexyl)-3-[3-(1-iodocyclopropyl)propyl]-2,4-dimethylbenzene |
| SMILES | CCC(C)(C)CCCc1ccc(C)c(CCCC2(I)CC2)c1C |
| InChI | InChI=1S/C22H35I/c1-6-21(4,5)13-7-9-19-12-11-17(2)20(18(19)3)10-8-14-22(23)15-16-22/h11-12H,6-10,13-16H2,1-5H3 |
| InChIKey | CQSBBXQQRXEURR-UHFFFAOYSA-N |
| XLogP | 7.35 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 426.43 |
| LogP ≤ 5 | 7.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 1-(4,4-dimethylhexyl)-3-[3-(1-iodocyclopropyl)propyl]-2,4-dimethylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4,4-dimethylhexyl)-3-[3-(1-iodocyclopropyl)propyl]-2,4-dimethylbenzene?
The IUPAC name of 1-(4,4-dimethylhexyl)-3-[3-(1-iodocyclopropyl)propyl]-2,4-dimethylbenzene (CID 170105111) is 1-(4,4-dimethylhexyl)-3-[3-(1-iodocyclopropyl)propyl]-2,4-dimethylbenzene.
What is the SMILES notation for 1-(4,4-dimethylhexyl)-3-[3-(1-iodocyclopropyl)propyl]-2,4-dimethylbenzene?
The canonical SMILES for 1-(4,4-dimethylhexyl)-3-[3-(1-iodocyclopropyl)propyl]-2,4-dimethylbenzene is CCC(C)(C)CCCc1ccc(C)c(CCCC2(I)CC2)c1C.
What is the InChIKey of 1-(4,4-dimethylhexyl)-3-[3-(1-iodocyclopropyl)propyl]-2,4-dimethylbenzene?
The InChIKey is CQSBBXQQRXEURR-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H35I/c1-6-21(4,5)13-7-9-19-12-11-17(2)20(18(19)3)10-8-14-22(23)15-16-22/h11-12H,6-10,13-16H2,1-5H3.
What are the key properties of 1-(4,4-dimethylhexyl)-3-[3-(1-iodocyclopropyl)propyl]-2,4-dimethylbenzene?
1-(4,4-dimethylhexyl)-3-[3-(1-iodocyclopropyl)propyl]-2,4-dimethylbenzene has a molecular weight of 426.43 g/mol, XLogP of 7.35, 9 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4,4-dimethylhexyl)-3-[3-(1-iodocyclopropyl)propyl]-2,4-dimethylbenzene is sourced from PubChem (CID 170105111), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).