C24H42O2 — CID 170105324
3-(5,5-dimethylhexyl)-5-(6,6-dimethyloctyl)benzene-1,2-diol (PubChem CID 170105324) has the molecular formula C24H42O2 and a molecular weight of 362.60 g/mol. Its IUPAC name is 3-(5,5-dimethylhexyl)-5-(6,6-dimethyloctyl)benzene-1,2-diol.
| Compound Name | 3-(5,5-dimethylhexyl)-5-(6,6-dimethyloctyl)benzene-1,2-diol |
|---|---|
| PubChem CID | 170105324 |
| Molecular Formula | C24H42O2 |
| Molecular Weight | 362.60 g/mol |
| Exact Mass | 362.32 |
| IUPAC Name | 3-(5,5-dimethylhexyl)-5-(6,6-dimethyloctyl)benzene-1,2-diol |
| SMILES | CCC(C)(C)CCCCCc1cc(O)c(O)c(CCCCC(C)(C)C)c1 |
| InChI | InChI=1S/C24H42O2/c1-7-24(5,6)16-11-8-9-13-19-17-20(22(26)21(25)18-19)14-10-12-15-23(2,3)4/h17-18,25-26H,7-16H2,1-6H3 |
| InChIKey | UNGPDNQGSPZKEG-UHFFFAOYSA-N |
| XLogP | 7.40 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.60 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|