C24H42O — CID 170105299
4-(5,5-dimethylhexyl)-2-(6,6-dimethyloctyl)phenol (PubChem CID 170105299) has the molecular formula C24H42O and a molecular weight of 346.60 g/mol. Its IUPAC name is 4-(5,5-dimethylhexyl)-2-(6,6-dimethyloctyl)phenol.
| Compound Name | 4-(5,5-dimethylhexyl)-2-(6,6-dimethyloctyl)phenol |
|---|---|
| PubChem CID | 170105299 |
| Molecular Formula | C24H42O |
| Molecular Weight | 346.60 g/mol |
| Exact Mass | 346.32 |
| IUPAC Name | 4-(5,5-dimethylhexyl)-2-(6,6-dimethyloctyl)phenol |
| SMILES | CCC(C)(C)CCCCCc1cc(CCCCC(C)(C)C)ccc1O |
| InChI | InChI=1S/C24H42O/c1-7-24(5,6)18-11-8-9-14-21-19-20(15-16-22(21)25)13-10-12-17-23(2,3)4/h15-16,19,25H,7-14,17-18H2,1-6H3 |
| InChIKey | AOLXAGGPRUHTES-UHFFFAOYSA-N |
| XLogP | 7.69 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.60 |
| LogP ≤ 5 | 7.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|