C24H42O3 — CID 170103716
4,6-bis(6,6-dimethylheptyl)benzene-1,2,3-triol (PubChem CID 170103716) has the molecular formula C24H42O3 and a molecular weight of 378.60 g/mol. Its IUPAC name is 4,6-bis(6,6-dimethylheptyl)benzene-1,2,3-triol.
| Compound Name | 4,6-bis(6,6-dimethylheptyl)benzene-1,2,3-triol |
|---|---|
| PubChem CID | 170103716 |
| Molecular Formula | C24H42O3 |
| Molecular Weight | 378.60 g/mol |
| Exact Mass | 378.31 |
| IUPAC Name | 4,6-bis(6,6-dimethylheptyl)benzene-1,2,3-triol |
| SMILES | CC(C)(C)CCCCCc1cc(CCCCCC(C)(C)C)c(O)c(O)c1O |
| InChI | InChI=1S/C24H42O3/c1-23(2,3)15-11-7-9-13-18-17-19(21(26)22(27)20(18)25)14-10-8-12-16-24(4,5)6/h17,25-27H,7-16H2,1-6H3 |
| InChIKey | BWEWXBMZCQUXDW-UHFFFAOYSA-N |
| XLogP | 7.10 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.60 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|