C20H34O — CID 170103636
2,6-bis(4,4-dimethylpentyl)phenol (PubChem CID 170103636) has the molecular formula C20H34O and a molecular weight of 290.49 g/mol. Its IUPAC name is 2,6-bis(4,4-dimethylpentyl)phenol.
| Compound Name | 2,6-bis(4,4-dimethylpentyl)phenol |
|---|---|
| PubChem CID | 170103636 |
| Molecular Formula | C20H34O |
| Molecular Weight | 290.49 g/mol |
| Exact Mass | 290.26 |
| IUPAC Name | 2,6-bis(4,4-dimethylpentyl)phenol |
| SMILES | CC(C)(C)CCCc1cccc(CCCC(C)(C)C)c1O |
| InChI | InChI=1S/C20H34O/c1-19(2,3)14-8-12-16-10-7-11-17(18(16)21)13-9-15-20(4,5)6/h7,10-11,21H,8-9,12-15H2,1-6H3 |
| InChIKey | MMIZZVWXWNMARP-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.49 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |