C26H40O2 — CID 164594994
8-[2-[5-(1-acetylcyclopropyl)pentyl]phenyl]-3,3-dimethyloctan-2-one (PubChem CID 164594994) has the molecular formula C26H40O2 and a molecular weight of 384.60 g/mol. Its IUPAC name is 8-[2-[5-(1-acetylcyclopropyl)pentyl]phenyl]-3,3-dimethyloctan-2-one.
| Compound Name | 8-[2-[5-(1-acetylcyclopropyl)pentyl]phenyl]-3,3-dimethyloctan-2-one |
|---|---|
| PubChem CID | 164594994 |
| Molecular Formula | C26H40O2 |
| Molecular Weight | 384.60 g/mol |
| Exact Mass | 384.30 |
| IUPAC Name | 8-[2-[5-(1-acetylcyclopropyl)pentyl]phenyl]-3,3-dimethyloctan-2-one |
| SMILES | CC(=O)C(C)(C)CCCCCc1ccccc1CCCCCC1(C(C)=O)CC1 |
| InChI | InChI=1S/C26H40O2/c1-21(27)25(3,4)17-11-5-7-13-23-15-9-10-16-24(23)14-8-6-12-18-26(19-20-26)22(2)28/h9-10,15-16H,5-8,11-14,17-20H2,1-4H3 |
| InChIKey | PPXMMOSWDMZCHX-UHFFFAOYSA-N |
| XLogP | 6.88 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.60 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|