C27H40O3 — CID 164595174
1-[6-[2-[6-(1-acetylcyclopropyl)hexyl]phenyl]hexyl]cyclopropane-1-carboxylic acid (PubChem CID 164595174) has the molecular formula C27H40O3 and a molecular weight of 412.61 g/mol. Its IUPAC name is 1-[6-[2-[6-(1-acetylcyclopropyl)hexyl]phenyl]hexyl]cyclopropane-1-carboxylic acid.
| Compound Name | 1-[6-[2-[6-(1-acetylcyclopropyl)hexyl]phenyl]hexyl]cyclopropane-1-carboxylic acid |
|---|---|
| PubChem CID | 164595174 |
| Molecular Formula | C27H40O3 |
| Molecular Weight | 412.61 g/mol |
| Exact Mass | 412.30 |
| IUPAC Name | 1-[6-[2-[6-(1-acetylcyclopropyl)hexyl]phenyl]hexyl]cyclopropane-1-carboxylic acid |
| SMILES | CC(=O)C1(CCCCCCc2ccccc2CCCCCCC2(C(=O)O)CC2)CC1 |
| InChI | InChI=1S/C27H40O3/c1-22(28)26(18-19-26)16-10-4-2-6-12-23-14-8-9-15-24(23)13-7-3-5-11-17-27(20-21-27)25(29)30/h8-9,14-15H,2-7,10-13,16-21H2,1H3,(H,29,30) |
| InChIKey | NGNOUSPOBGOJNS-UHFFFAOYSA-N |
| XLogP | 6.91 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.61 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|