C27H42O3 — CID 164595162
1-[6-[3-(7,7-dimethyl-8-oxononyl)phenyl]hexyl]cyclopropane-1-carboxylic acid (PubChem CID 164595162) has the molecular formula C27H42O3 and a molecular weight of 414.63 g/mol. Its IUPAC name is 1-[6-[3-(7,7-dimethyl-8-oxononyl)phenyl]hexyl]cyclopropane-1-carboxylic acid.
| Compound Name | 1-[6-[3-(7,7-dimethyl-8-oxononyl)phenyl]hexyl]cyclopropane-1-carboxylic acid |
|---|---|
| PubChem CID | 164595162 |
| Molecular Formula | C27H42O3 |
| Molecular Weight | 414.63 g/mol |
| Exact Mass | 414.31 |
| IUPAC Name | 1-[6-[3-(7,7-dimethyl-8-oxononyl)phenyl]hexyl]cyclopropane-1-carboxylic acid |
| SMILES | CC(=O)C(C)(C)CCCCCCc1cccc(CCCCCCC2(C(=O)O)CC2)c1 |
| InChI | InChI=1S/C27H42O3/c1-22(28)26(2,3)17-10-6-4-8-13-23-15-12-16-24(21-23)14-9-5-7-11-18-27(19-20-27)25(29)30/h12,15-16,21H,4-11,13-14,17-20H2,1-3H3,(H,29,30) |
| InChIKey | GJVNYCQNJPCOTP-UHFFFAOYSA-N |
| XLogP | 7.15 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.63 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|