C14H24O5 — CID 169026744
5-[3-(1-formyloxycyclopropyl)propoxy]-2,2-dimethylpentanoic acid (PubChem CID 169026744) has the molecular formula C14H24O5 and a molecular weight of 272.34 g/mol. Its IUPAC name is 5-[3-(1-formyloxycyclopropyl)propoxy]-2,2-dimethylpentanoic acid.
| Compound Name | 5-[3-(1-formyloxycyclopropyl)propoxy]-2,2-dimethylpentanoic acid |
|---|---|
| PubChem CID | 169026744 |
| Molecular Formula | C14H24O5 |
| Molecular Weight | 272.34 g/mol |
| Exact Mass | 272.16 |
| IUPAC Name | 5-[3-(1-formyloxycyclopropyl)propoxy]-2,2-dimethylpentanoic acid |
| SMILES | CC(C)(CCCOCCCC1(OC=O)CC1)C(=O)O |
| InChI | InChI=1S/C14H24O5/c1-13(2,12(16)17)5-3-9-18-10-4-6-14(7-8-14)19-11-15/h11H,3-10H2,1-2H3,(H,16,17) |
| InChIKey | USZVWVBRLPSCOI-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.34 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|