C26H44 — CID 174103814
1-(6,6-dimethylheptyl)-2,3-dimethyl-4-[5-(1-methylcyclopropyl)pentyl]benzene (PubChem CID 174103814) has the molecular formula C26H44 and a molecular weight of 356.64 g/mol. Its IUPAC name is 1-(6,6-dimethylheptyl)-2,3-dimethyl-4-[5-(1-methylcyclopropyl)pentyl]benzene.
| Compound Name | 1-(6,6-dimethylheptyl)-2,3-dimethyl-4-[5-(1-methylcyclopropyl)pentyl]benzene |
|---|---|
| PubChem CID | 174103814 |
| Molecular Formula | C26H44 |
| Molecular Weight | 356.64 g/mol |
| Exact Mass | 356.34 |
| IUPAC Name | 1-(6,6-dimethylheptyl)-2,3-dimethyl-4-[5-(1-methylcyclopropyl)pentyl]benzene |
| SMILES | Cc1c(CCCCCC(C)(C)C)ccc(CCCCCC2(C)CC2)c1C |
| InChI | InChI=1S/C26H44/c1-21-22(2)24(14-10-8-12-18-26(6)19-20-26)16-15-23(21)13-9-7-11-17-25(3,4)5/h15-16H,7-14,17-20H2,1-6H3 |
| InChIKey | QNTCGPKAOPHBTC-UHFFFAOYSA-N |
| XLogP | 8.36 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.64 |
| LogP ≤ 5 | 8.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|