C14H18 — CID 173045911
1-but-3-ynyl-2,3,4,5-tetramethylbenzene (PubChem CID 173045911) has the molecular formula C14H18 and a molecular weight of 186.30 g/mol. Its IUPAC name is 1-but-3-ynyl-2,3,4,5-tetramethylbenzene.
| Compound Name | 1-but-3-ynyl-2,3,4,5-tetramethylbenzene |
|---|---|
| PubChem CID | 173045911 |
| Molecular Formula | C14H18 |
| Molecular Weight | 186.30 g/mol |
| Exact Mass | 186.14 |
| IUPAC Name | 1-but-3-ynyl-2,3,4,5-tetramethylbenzene |
| SMILES | C#CCCc1cc(C)c(C)c(C)c1C |
| InChI | InChI=1S/C14H18/c1-6-7-8-14-9-10(2)11(3)12(4)13(14)5/h1,9H,7-8H2,2-5H3 |
| InChIKey | XZEOFMISNVGEHI-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.30 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|