C14H20O — CID 83940244
2-but-3-enyl-5-ethoxy-1,3-dimethylbenzene (PubChem CID 83940244) has the molecular formula C14H20O and a molecular weight of 204.31 g/mol. Its IUPAC name is 2-but-3-enyl-5-ethoxy-1,3-dimethylbenzene.
| Compound Name | 2-but-3-enyl-5-ethoxy-1,3-dimethylbenzene |
|---|---|
| PubChem CID | 83940244 |
| Molecular Formula | C14H20O |
| Molecular Weight | 204.31 g/mol |
| Exact Mass | 204.15 |
| IUPAC Name | 2-but-3-enyl-5-ethoxy-1,3-dimethylbenzene |
| SMILES | C=CCCc1c(C)cc(OCC)cc1C |
| InChI | InChI=1S/C14H20O/c1-5-7-8-14-11(3)9-13(15-6-2)10-12(14)4/h5,9-10H,1,6-8H2,2-4H3 |
| InChIKey | GBOZVGPHVDVUNC-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.31 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|