C12H21Cl2NOZn — CID 70476800
4-ethoxy-N,N,2,6-tetramethylaniline;zinc;dihydrochloride (PubChem CID 70476800) has the molecular formula C12H21Cl2NOZn and a molecular weight of 331.60 g/mol. Its IUPAC name is 4-ethoxy-N,N,2,6-tetramethylaniline;zinc;dihydrochloride.
| Compound Name | 4-ethoxy-N,N,2,6-tetramethylaniline;zinc;dihydrochloride |
|---|---|
| PubChem CID | 70476800 |
| Molecular Formula | C12H21Cl2NOZn |
| Molecular Weight | 331.60 g/mol |
| Exact Mass | 329.03 |
| IUPAC Name | 4-ethoxy-N,N,2,6-tetramethylaniline;zinc;dihydrochloride |
| SMILES | CCOc1cc(C)c(N(C)C)c(C)c1.Cl.Cl.[Zn] |
| InChI | InChI=1S/C12H19NO.2ClH.Zn/c1-6-14-11-7-9(2)12(13(4)5)10(3)8-11;;;/h7-8H,6H2,1-5H3;2*1H; |
| InChIKey | RWHXANOKRFBJQK-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.60 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|