C11H17NO — CID 54263665
5-ethoxy-N,N,2-trimethylaniline (PubChem CID 54263665) has the molecular formula C11H17NO and a molecular weight of 179.26 g/mol. Its IUPAC name is 5-ethoxy-N,N,2-trimethylaniline.
| Compound Name | 5-ethoxy-N,N,2-trimethylaniline |
|---|---|
| PubChem CID | 54263665 |
| Molecular Formula | C11H17NO |
| Molecular Weight | 179.26 g/mol |
| Exact Mass | 179.13 |
| IUPAC Name | 5-ethoxy-N,N,2-trimethylaniline |
| SMILES | CCOc1ccc(C)c(N(C)C)c1 |
| InChI | InChI=1S/C11H17NO/c1-5-13-10-7-6-9(2)11(8-10)12(3)4/h6-8H,5H2,1-4H3 |
| InChIKey | RFGDWKFCKURCEP-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.26 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |