C22H31NO — CID 176968347
5-(4-heptan-4-yloxyphenyl)-N,N,2-trimethylaniline (PubChem CID 176968347) has the molecular formula C22H31NO and a molecular weight of 325.50 g/mol. Its IUPAC name is 5-(4-heptan-4-yloxyphenyl)-N,N,2-trimethylaniline.
| Compound Name | 5-(4-heptan-4-yloxyphenyl)-N,N,2-trimethylaniline |
|---|---|
| PubChem CID | 176968347 |
| Molecular Formula | C22H31NO |
| Molecular Weight | 325.50 g/mol |
| Exact Mass | 325.24 |
| IUPAC Name | 5-(4-heptan-4-yloxyphenyl)-N,N,2-trimethylaniline |
| SMILES | CCCC(CCC)Oc1ccc(-c2ccc(C)c(N(C)C)c2)cc1 |
| InChI | InChI=1S/C22H31NO/c1-6-8-20(9-7-2)24-21-14-12-18(13-15-21)19-11-10-17(3)22(16-19)23(4)5/h10-16,20H,6-9H2,1-5H3 |
| InChIKey | FDHWMBGBFXYUTL-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.50 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |