About 5-(4-heptan-4-yloxyphenyl)-N,N,2-trimethylaniline
5-(4-heptan-4-yloxyphenyl)-N,N,2-trimethylaniline (PubChem CID 176968347) has the molecular formula C22H31NO
and a molecular weight of 325.50 g/mol. Its IUPAC name is 5-(4-heptan-4-yloxyphenyl)-N,N,2-trimethylaniline.
Molecular Properties
| Compound Name | 5-(4-heptan-4-yloxyphenyl)-N,N,2-trimethylaniline |
| PubChem CID | 176968347 |
| Molecular Formula | C22H31NO |
| Molecular Weight | 325.50 g/mol |
| Exact Mass | 325.24 |
| IUPAC Name | 5-(4-heptan-4-yloxyphenyl)-N,N,2-trimethylaniline |
| SMILES | CCCC(CCC)Oc1ccc(-c2ccc(C)c(N(C)C)c2)cc1 |
| InChI | InChI=1S/C22H31NO/c1-6-8-20(9-7-2)24-21-14-12-18(13-15-21)19-11-10-17(3)22(16-19)23(4)5/h10-16,20H,6-9H2,1-5H3 |
| InChIKey | FDHWMBGBFXYUTL-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 325.50 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-(4-heptan-4-yloxyphenyl)-N,N,2-trimethylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(4-heptan-4-yloxyphenyl)-N,N,2-trimethylaniline?
The IUPAC name of 5-(4-heptan-4-yloxyphenyl)-N,N,2-trimethylaniline (CID 176968347) is 5-(4-heptan-4-yloxyphenyl)-N,N,2-trimethylaniline.
What is the SMILES notation for 5-(4-heptan-4-yloxyphenyl)-N,N,2-trimethylaniline?
The canonical SMILES for 5-(4-heptan-4-yloxyphenyl)-N,N,2-trimethylaniline is CCCC(CCC)Oc1ccc(-c2ccc(C)c(N(C)C)c2)cc1.
What is the InChIKey of 5-(4-heptan-4-yloxyphenyl)-N,N,2-trimethylaniline?
The InChIKey is FDHWMBGBFXYUTL-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H31NO/c1-6-8-20(9-7-2)24-21-14-12-18(13-15-21)19-11-10-17(3)22(16-19)23(4)5/h10-16,20H,6-9H2,1-5H3.
What are the key properties of 5-(4-heptan-4-yloxyphenyl)-N,N,2-trimethylaniline?
5-(4-heptan-4-yloxyphenyl)-N,N,2-trimethylaniline has a molecular weight of 325.50 g/mol, XLogP of 6.08, 8 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(4-heptan-4-yloxyphenyl)-N,N,2-trimethylaniline is sourced from PubChem (CID 176968347), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).