C10H12N2 — CID 142880366
1-(2,5-dimethyl-3-pyridinyl)-N-ethenylmethanimine (PubChem CID 142880366) has the molecular formula C10H12N2 and a molecular weight of 160.22 g/mol. Its IUPAC name is 1-(2,5-dimethyl-3-pyridinyl)-N-ethenylmethanimine.
| Compound Name | 1-(2,5-dimethyl-3-pyridinyl)-N-ethenylmethanimine |
|---|---|
| PubChem CID | 142880366 |
| Molecular Formula | C10H12N2 |
| Molecular Weight | 160.22 g/mol |
| Exact Mass | 160.10 |
| IUPAC Name | 1-(2,5-dimethyl-3-pyridinyl)-N-ethenylmethanimine |
| SMILES | C=C/N=C/c1cc(C)cnc1C |
| InChI | InChI=1S/C10H12N2/c1-4-11-7-10-5-8(2)6-12-9(10)3/h4-7H,1H2,2-3H3/b11-7+ |
| InChIKey | IMYBACBNTJJPAA-YRNVUSSQSA-N |
| XLogP | 2.26 |
| TPSA | 25.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.22 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|