C8H8INS — CID 126737609
4-[(1Z)-buta-1,3-dienyl]-2-iodo-5-methyl-1,3-thiazole (PubChem CID 126737609) has the molecular formula C8H8INS and a molecular weight of 277.13 g/mol. Its IUPAC name is 4-[(1Z)-buta-1,3-dienyl]-2-iodo-5-methyl-1,3-thiazole.
| Compound Name | 4-[(1Z)-buta-1,3-dienyl]-2-iodo-5-methyl-1,3-thiazole |
|---|---|
| PubChem CID | 126737609 |
| Molecular Formula | C8H8INS |
| Molecular Weight | 277.13 g/mol |
| Exact Mass | 276.94 |
| IUPAC Name | 4-[(1Z)-buta-1,3-dienyl]-2-iodo-5-methyl-1,3-thiazole |
| SMILES | C=C/C=C\c1nc(I)sc1C |
| InChI | InChI=1S/C8H8INS/c1-3-4-5-7-6(2)11-8(9)10-7/h3-5H,1H2,2H3/b5-4- |
| InChIKey | MUEXIQNOGJGEBD-PLNGDYQASA-N |
| XLogP | 3.26 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.13 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|