C15H15NS — CID 143688553
4-[(1Z)-buta-1,3-dienyl]-5-methyl-2-(4-methylphenyl)-1,3-thiazole (PubChem CID 143688553) has the molecular formula C15H15NS and a molecular weight of 241.36 g/mol. Its IUPAC name is 4-[(1Z)-buta-1,3-dienyl]-5-methyl-2-(4-methylphenyl)-1,3-thiazole.
| Compound Name | 4-[(1Z)-buta-1,3-dienyl]-5-methyl-2-(4-methylphenyl)-1,3-thiazole |
|---|---|
| PubChem CID | 143688553 |
| Molecular Formula | C15H15NS |
| Molecular Weight | 241.36 g/mol |
| Exact Mass | 241.09 |
| IUPAC Name | 4-[(1Z)-buta-1,3-dienyl]-5-methyl-2-(4-methylphenyl)-1,3-thiazole |
| SMILES | C=C/C=C\c1nc(-c2ccc(C)cc2)sc1C |
| InChI | InChI=1S/C15H15NS/c1-4-5-6-14-12(3)17-15(16-14)13-9-7-11(2)8-10-13/h4-10H,1H2,2-3H3/b6-5- |
| InChIKey | XKWPNDIOPLGMOJ-WAYWQWQTSA-N |
| XLogP | 4.63 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.36 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|