C9H11NS — CID 138552173
4-[(1Z)-buta-1,3-dienyl]-5-methylthiophen-2-amine (PubChem CID 138552173) has the molecular formula C9H11NS and a molecular weight of 165.26 g/mol. Its IUPAC name is 4-[(1Z)-buta-1,3-dienyl]-5-methylthiophen-2-amine.
| Compound Name | 4-[(1Z)-buta-1,3-dienyl]-5-methylthiophen-2-amine |
|---|---|
| PubChem CID | 138552173 |
| Molecular Formula | C9H11NS |
| Molecular Weight | 165.26 g/mol |
| Exact Mass | 165.06 |
| IUPAC Name | 4-[(1Z)-buta-1,3-dienyl]-5-methylthiophen-2-amine |
| SMILES | C=C/C=C\c1cc(N)sc1C |
| InChI | InChI=1S/C9H11NS/c1-3-4-5-8-6-9(10)11-7(8)2/h3-6H,1,10H2,2H3/b5-4- |
| InChIKey | ANNBFRGCVLKUMM-PLNGDYQASA-N |
| XLogP | 2.84 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.26 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|