C16H29NS — CID 170620892
5-[(1Z)-buta-1,3-dienyl]-4-ethenyl-1,3-thiazole;ethane;propane (PubChem CID 170620892) has the molecular formula C16H29NS and a molecular weight of 267.48 g/mol. Its IUPAC name is 5-[(1Z)-buta-1,3-dienyl]-4-ethenyl-1,3-thiazole;ethane;propane.
| Compound Name | 5-[(1Z)-buta-1,3-dienyl]-4-ethenyl-1,3-thiazole;ethane;propane |
|---|---|
| PubChem CID | 170620892 |
| Molecular Formula | C16H29NS |
| Molecular Weight | 267.48 g/mol |
| Exact Mass | 267.20 |
| IUPAC Name | 5-[(1Z)-buta-1,3-dienyl]-4-ethenyl-1,3-thiazole;ethane;propane |
| SMILES | C=C/C=C\c1scnc1C=C.CC.CC.CCC |
| InChI | InChI=1S/C9H9NS.C3H8.2C2H6/c1-3-5-6-9-8(4-2)10-7-11-9;1-3-2;2*1-2/h3-7H,1-2H2;3H2,1-2H3;2*1-2H3/b6-5-;;; |
| InChIKey | BLLYQIJZQWJBIS-WTUPQPTJSA-N |
| XLogP | 6.45 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.48 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|