C12H19NS — CID 164562053
ethane;5-ethyl-4-[(1Z)-2-methylbuta-1,3-dienyl]-1,3-thiazole (PubChem CID 164562053) has the molecular formula C12H19NS and a molecular weight of 209.36 g/mol. Its IUPAC name is ethane;5-ethyl-4-[(1Z)-2-methylbuta-1,3-dienyl]-1,3-thiazole.
| Compound Name | ethane;5-ethyl-4-[(1Z)-2-methylbuta-1,3-dienyl]-1,3-thiazole |
|---|---|
| PubChem CID | 164562053 |
| Molecular Formula | C12H19NS |
| Molecular Weight | 209.36 g/mol |
| Exact Mass | 209.12 |
| IUPAC Name | ethane;5-ethyl-4-[(1Z)-2-methylbuta-1,3-dienyl]-1,3-thiazole |
| SMILES | C=C/C(C)=C\c1ncsc1CC.CC |
| InChI | InChI=1S/C10H13NS.C2H6/c1-4-8(3)6-9-10(5-2)12-7-11-9;1-2/h4,6-7H,1,5H2,2-3H3;1-2H3/b8-6-; |
| InChIKey | HBDWVOCRXMNVKN-PHZXCRFESA-N |
| XLogP | 4.32 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.36 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|