C10H12N2 — CID 138980431
4-[(1Z)-2-methylbuta-1,3-dienyl]pyridin-2-amine (PubChem CID 138980431) has the molecular formula C10H12N2 and a molecular weight of 160.22 g/mol. Its IUPAC name is 4-[(1Z)-2-methylbuta-1,3-dienyl]pyridin-2-amine.
| Compound Name | 4-[(1Z)-2-methylbuta-1,3-dienyl]pyridin-2-amine |
|---|---|
| PubChem CID | 138980431 |
| Molecular Formula | C10H12N2 |
| Molecular Weight | 160.22 g/mol |
| Exact Mass | 160.10 |
| IUPAC Name | 4-[(1Z)-2-methylbuta-1,3-dienyl]pyridin-2-amine |
| SMILES | C=C/C(C)=C\c1ccnc(N)c1 |
| InChI | InChI=1S/C10H12N2/c1-3-8(2)6-9-4-5-12-10(11)7-9/h3-7H,1H2,2H3,(H2,11,12)/b8-6- |
| InChIKey | IVHYVXMXKJQKJR-VURMDHGXSA-N |
| XLogP | 2.25 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.22 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|