C22H24N2 — CID 90693248
4-[3-ethenyl-5-methylidene-7-(3-methylphenyl)hepta-3,6-dienyl]pyridin-2-amine (PubChem CID 90693248) has the molecular formula C22H24N2 and a molecular weight of 316.45 g/mol. Its IUPAC name is 4-[3-ethenyl-5-methylidene-7-(3-methylphenyl)hepta-3,6-dienyl]pyridin-2-amine.
| Compound Name | 4-[3-ethenyl-5-methylidene-7-(3-methylphenyl)hepta-3,6-dienyl]pyridin-2-amine |
|---|---|
| PubChem CID | 90693248 |
| Molecular Formula | C22H24N2 |
| Molecular Weight | 316.45 g/mol |
| Exact Mass | 316.19 |
| IUPAC Name | 4-[3-ethenyl-5-methylidene-7-(3-methylphenyl)hepta-3,6-dienyl]pyridin-2-amine |
| SMILES | C=CC(=CC(=C)C=Cc1cccc(C)c1)CCc1ccnc(N)c1 |
| InChI | InChI=1S/C22H24N2/c1-4-19(10-11-21-12-13-24-22(23)16-21)14-18(3)8-9-20-7-5-6-17(2)15-20/h4-9,12-16H,1,3,10-11H2,2H3,(H2,23,24) |
| InChIKey | MICYKHHWSSQFSC-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.45 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|