C22H32N2 — CID 58467868
4-[3-ethyl-5-methyl-7-(3-methylphenyl)heptyl]pyridin-2-amine (PubChem CID 58467868) has the molecular formula C22H32N2 and a molecular weight of 324.51 g/mol. Its IUPAC name is 4-[3-ethyl-5-methyl-7-(3-methylphenyl)heptyl]pyridin-2-amine.
| Compound Name | 4-[3-ethyl-5-methyl-7-(3-methylphenyl)heptyl]pyridin-2-amine |
|---|---|
| PubChem CID | 58467868 |
| Molecular Formula | C22H32N2 |
| Molecular Weight | 324.51 g/mol |
| Exact Mass | 324.26 |
| IUPAC Name | 4-[3-ethyl-5-methyl-7-(3-methylphenyl)heptyl]pyridin-2-amine |
| SMILES | CCC(CCc1ccnc(N)c1)CC(C)CCc1cccc(C)c1 |
| InChI | InChI=1S/C22H32N2/c1-4-19(10-11-21-12-13-24-22(23)16-21)14-18(3)8-9-20-7-5-6-17(2)15-20/h5-7,12-13,15-16,18-19H,4,8-11,14H2,1-3H3,(H2,23,24) |
| InChIKey | JSMYFQGOWKMXEK-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.51 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |