C9H11NO — CID 162433199
4-methyl-5-[(1Z)-2-methylbuta-1,3-dienyl]-1,3-oxazole (PubChem CID 162433199) has the molecular formula C9H11NO and a molecular weight of 149.19 g/mol. Its IUPAC name is 4-methyl-5-[(1Z)-2-methylbuta-1,3-dienyl]-1,3-oxazole.
| Compound Name | 4-methyl-5-[(1Z)-2-methylbuta-1,3-dienyl]-1,3-oxazole |
|---|---|
| PubChem CID | 162433199 |
| Molecular Formula | C9H11NO |
| Molecular Weight | 149.19 g/mol |
| Exact Mass | 149.08 |
| IUPAC Name | 4-methyl-5-[(1Z)-2-methylbuta-1,3-dienyl]-1,3-oxazole |
| SMILES | C=C/C(C)=C\c1ocnc1C |
| InChI | InChI=1S/C9H11NO/c1-4-7(2)5-9-8(3)10-6-11-9/h4-6H,1H2,2-3H3/b7-5- |
| InChIKey | BIEPBFSJGDLXPZ-ALCCZGGFSA-N |
| XLogP | 2.57 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 149.19 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|