C11H15N — CID 144533587
1,2-dimethyl-3-[(1Z)-2-methylbuta-1,3-dienyl]pyrrole (PubChem CID 144533587) has the molecular formula C11H15N and a molecular weight of 161.25 g/mol. Its IUPAC name is 1,2-dimethyl-3-[(1Z)-2-methylbuta-1,3-dienyl]pyrrole.
| Compound Name | 1,2-dimethyl-3-[(1Z)-2-methylbuta-1,3-dienyl]pyrrole |
|---|---|
| PubChem CID | 144533587 |
| Molecular Formula | C11H15N |
| Molecular Weight | 161.25 g/mol |
| Exact Mass | 161.12 |
| IUPAC Name | 1,2-dimethyl-3-[(1Z)-2-methylbuta-1,3-dienyl]pyrrole |
| SMILES | C=C/C(C)=C\c1ccn(C)c1C |
| InChI | InChI=1S/C11H15N/c1-5-9(2)8-11-6-7-12(4)10(11)3/h5-8H,1H2,2-4H3/b9-8- |
| InChIKey | FJONVTZKFNEXDN-HJWRWDBZSA-N |
| XLogP | 2.92 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.25 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|