C10H14N2O — CID 130670164
1,3-dimethyl-N-prop-2-enylpyrrole-2-carboxamide (PubChem CID 130670164) has the molecular formula C10H14N2O and a molecular weight of 178.23 g/mol. Its IUPAC name is 1,3-dimethyl-N-prop-2-enylpyrrole-2-carboxamide.
| Compound Name | 1,3-dimethyl-N-prop-2-enylpyrrole-2-carboxamide |
|---|---|
| PubChem CID | 130670164 |
| Molecular Formula | C10H14N2O |
| Molecular Weight | 178.23 g/mol |
| Exact Mass | 178.11 |
| IUPAC Name | 1,3-dimethyl-N-prop-2-enylpyrrole-2-carboxamide |
| SMILES | C=CCNC(=O)c1c(C)ccn1C |
| InChI | InChI=1S/C10H14N2O/c1-4-6-11-10(13)9-8(2)5-7-12(9)3/h4-5,7H,1,6H2,2-3H3,(H,11,13) |
| InChIKey | HCWWJJWTJTXHGM-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.23 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|