C11H12ClNO — CID 103775370
4-chloro-2-methyl-N-prop-2-enylbenzamide (PubChem CID 103775370) has the molecular formula C11H12ClNO and a molecular weight of 209.68 g/mol. Its IUPAC name is 4-chloro-2-methyl-N-prop-2-enylbenzamide.
| Compound Name | 4-chloro-2-methyl-N-prop-2-enylbenzamide |
|---|---|
| PubChem CID | 103775370 |
| Molecular Formula | C11H12ClNO |
| Molecular Weight | 209.68 g/mol |
| Exact Mass | 209.06 |
| IUPAC Name | 4-chloro-2-methyl-N-prop-2-enylbenzamide |
| SMILES | C=CCNC(=O)c1ccc(Cl)cc1C |
| InChI | InChI=1S/C11H12ClNO/c1-3-6-13-11(14)10-5-4-9(12)7-8(10)2/h3-5,7H,1,6H2,2H3,(H,13,14) |
| InChIKey | AESLQWFUVVVWNT-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.68 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|