C11H12ClNO3S — CID 61292327
4-methyl-3-(prop-2-enylcarbamoyl)benzenesulfonyl chloride (PubChem CID 61292327) has the molecular formula C11H12ClNO3S and a molecular weight of 273.74 g/mol. Its IUPAC name is 4-methyl-3-(prop-2-enylcarbamoyl)benzenesulfonyl chloride.
| Compound Name | 4-methyl-3-(prop-2-enylcarbamoyl)benzenesulfonyl chloride |
|---|---|
| PubChem CID | 61292327 |
| Molecular Formula | C11H12ClNO3S |
| Molecular Weight | 273.74 g/mol |
| Exact Mass | 273.02 |
| IUPAC Name | 4-methyl-3-(prop-2-enylcarbamoyl)benzenesulfonyl chloride |
| SMILES | C=CCNC(=O)c1cc(S(=O)(=O)Cl)ccc1C |
| InChI | InChI=1S/C11H12ClNO3S/c1-3-6-13-11(14)10-7-9(17(12,15)16)5-4-8(10)2/h3-5,7H,1,6H2,2H3,(H,13,14) |
| InChIKey | BMKFNIBIWOVCHG-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.74 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|