C16H16FN — CID 144654626
5-(4-fluorophenyl)-2-methyl-3-[(1Z)-2-methylbuta-1,3-dienyl]-1H-pyrrole (PubChem CID 144654626) has the molecular formula C16H16FN and a molecular weight of 241.31 g/mol. Its IUPAC name is 5-(4-fluorophenyl)-2-methyl-3-[(1Z)-2-methylbuta-1,3-dienyl]-1H-pyrrole.
| Compound Name | 5-(4-fluorophenyl)-2-methyl-3-[(1Z)-2-methylbuta-1,3-dienyl]-1H-pyrrole |
|---|---|
| PubChem CID | 144654626 |
| Molecular Formula | C16H16FN |
| Molecular Weight | 241.31 g/mol |
| Exact Mass | 241.13 |
| IUPAC Name | 5-(4-fluorophenyl)-2-methyl-3-[(1Z)-2-methylbuta-1,3-dienyl]-1H-pyrrole |
| SMILES | C=C/C(C)=C\c1cc(-c2ccc(F)cc2)[nH]c1C |
| InChI | InChI=1S/C16H16FN/c1-4-11(2)9-14-10-16(18-12(14)3)13-5-7-15(17)8-6-13/h4-10,18H,1H2,2-3H3/b11-9- |
| InChIKey | DFFSIHGVWBQNAE-LUAWRHEFSA-N |
| XLogP | 4.72 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.31 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|